Cyclopropane-2,2,3,3-d4-carboxylic acid is a deuterium-labeled research compound used in analytical and synthetic chemistry. Its primary significance lies in its application as a stable isotope-labeled reagent for studying reaction mechanisms and metabolic pathways.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 89924-82-3
4-Bromobenzoic-d4 Acid
Deuterated research compound
1-BROMOHEPTANE-D15
Deuterated research compound
2-PYRROLIDINONE-3,3,4,4,5,5-D6
Deuterated research compound
2-BROMOPYRIDINE-D4
Deuterated research compound
5-Hydroxy-2-methylnicotinic acid
research compound
Methyl 4-iodo-3-nitrobenzoate
research compound for local anesthetic studies
3,4-dimethoxyphenylmagnesium bromide
Grignard reagent for organic synthesis
(R)-4-hydroxy-N,N-diphenylpent-2-ynamide
research compound
2,2,3,3-tetradeuteriocyclopropane-1-carboxylic acid
YMGUBTXCNDTFJI-LNLMKGTHSA-N
[2H]C1(C(C1([2H])[2H])C(=O)O)[2H]
—