Methyl 4-iodo-3-nitrobenzoate is a research compound studied for its potential local anesthetic properties. It is structurally related to dimethocaine and is primarily used in laboratory investigations of anesthetic activity.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 89976-27-2
3,4-dimethoxyphenylmagnesium bromide
Grignard reagent for organic synthesis
(R)-4-hydroxy-N,N-diphenylpent-2-ynamide
research compound
(E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid
Research compound
Magnesium chloride 3,5-dimethoxybenzen-1-ide (1/1/1)
Grignard reagent for organic synthesis
methyl 4-iodo-3-nitrobenzoate
SCMBIQRYVKITCY-UHFFFAOYSA-N
COC(=O)C1=CC(=C(C=C1)I)[N+](=O)[O-]