Methyl 2-acetamido-2-(dimethoxyphosphoryl)acetate is a research reagent identified by the code Ac-D-Gly(PO(OMe)2)-OMe. It is a phosphorylated amino acid derivative commonly used as a laboratory compound in chemical synthesis and biochemical studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 89524-99-2
4-Chloropyrido[4,3-d]pyrimidine
Research reagent
5-Chloro-2-methoxyphenylboronic acid
Boronic acid research compound
4-Bromo-3-nitro-1H-pyrazole
research compound
2-Isopropylbenzeneboronic acid
research compound
methyl 2-acetamido-2-dimethoxyphosphorylacetate
MXNIODZSMNMILW-UHFFFAOYSA-N
CC(=O)NC(C(=O)OC)P(=O)(OC)OC