5-Chloro-2-methoxyphenylboronic acid is a boronic acid compound used as a research reagent. It contains an aromatic ring, an ether group, and a halogen atom, and is commonly employed in organic synthesis for the preparation of more complex molecules.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 89694-48-4
(3-Phenylnaphthalen-1-yl)boronic acid
Boronic acid research compound
(3-phenylphenyl)boronic Acid
Boronic acid research compound
1-Naphthaleneboronic acid
Boronic acid research compound
3,5-Dimethylisoxazole-4-boronic acid
Boronic acid research compound
4-Bromo-3-nitro-1H-pyrazole
research compound
2-Isopropylbenzeneboronic acid
research compound
5-(Ethylthio)-1H-tetrazole
Oligonucleotide synthesis activator
1-(chloromethyl)-3-(trifluoromethoxy)benzene
research compound
(5-chloro-2-methoxyphenyl)boronic acid
FMBVAOHFMSQDGT-UHFFFAOYSA-N
B(C1=C(C=CC(=C1)Cl)OC)(O)O
—