(4-Chloro-3-cyanophenyl)boronic acid is a boronic acid derivative used as a pharmaceutical intermediate in chemical synthesis. Its structure features an aromatic ring substituted with a chloro group, a nitrile group, and a boronic acid moiety.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 871332-95-5
3-((2S,5S)-5-((3R,5R)-5-Methyl-3-((methylsulfonyl)oxy)-6-(((trifluoromethyl)sulfonyl)oxy)hept-6-en-1-yl)-4-methylenetetrahydrofuran-2-yl)propyl pivalate
pharmaceutical intermediate
(1R,3S,5R,6R,7S,11R,14S,15S,16S,17R,18S,19S,20Z,22R,25S,28S,31S,33R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-16,17,19-tris[[tert-butyl(dimethyl)silyl]oxy]-22-hydroxy-6-methoxy-33-methyl-27,34-dimethylidene-4,35,36,37,38-pentaoxahexacyclo[29.3.1.111,15.114,18.125,28.03,7]octatriacont-20-en-9-one
pharmaceutical intermediate for complex polyether synthesis
1-Cinnamylpiperazine
Pharmaceutical intermediate for flunarizine
3-BROMOTHIOPHENE
Pharmaceutical intermediate for antibiotics and vasodilators
(4-chloro-3-cyanophenyl)boronic acid
PRPLADNLEYNYFZ-UHFFFAOYSA-N
B(C1=CC(=C(C=C1)Cl)C#N)(O)O