This compound is a protected polyether intermediate featuring multiple silyl-ether groups and a complex fused-ring system, designed for use in the stereocontrolled synthesis of structurally elaborate polyether natural products. It serves as a building block in pharmaceutical research and development, particularly for constructing molecules with intricate oxygen-containing ring frameworks.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 871360-42-8
1-Cinnamylpiperazine
Pharmaceutical intermediate for flunarizine
3-BROMOTHIOPHENE
Pharmaceutical intermediate for antibiotics and vasodilators
5-Fluoropyridine-3-boronic acid
Pharmaceutical intermediate for synthesis
(R)-2-Aminopent-4-ynoic acid hydrochloride
Pharmaceutical intermediate for amino acid derivatives
(1R,3S,5R,6R,7S,11R,14S,15S,16S,17R,18S,19S,20Z,22R,25S,28S,31S,33R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-16,17,19-tris[[tert-butyl(dimethyl)silyl]oxy]-22-hydroxy-6-methoxy-33-methyl-27,34-dimethylidene-4,35,36,37,38-pentaoxahexacyclo[29.3.1.111,15.114,18.125,28.03,7]octatriacont-20-en-9-one
OPIRHZLSIAZMNY-HEXWNEAUSA-N
C[C@@H]1C[C@@H]2CC[C@H]3C(=C)C[C@@H](O3)CC[C@H](/C=C\[C@@H]([C@H]4[C@H]([C@H]([C@@H]5[C@@H](O4)CC[C@@H](O5)CC(=O)C[C@H]6[C@H](C[C@H](C1=C)O2)O[C@@H]([C@@H]6OC)C[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O