Boc-Val-Cit-OH is a peptide compound featuring a tert-butoxycarbonyl (Boc) protecting group on the N-terminus and a citrulline residue. It is primarily used as a research compound in laboratory settings, particularly for peptide synthesis and biochemical studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 870487-08-4
Boc-Val-Cit-PABA
research compound for ADC
5-Chloro-3-iodo-2-methylaniline
research compound
4-(1-Naphthyl)phenylboronic Acid (contains varying amounts of Anhydride)
synthetic building block for cross-coupling
2-AMINO-N,3-DIMETHYLBENZAMIDE
research compound for crystallography
(2S)-5-(carbamoylamino)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]pentanoic acid
ZZLNUAVYYRBTOZ-QWRGUYRKSA-N
CC(C)[C@@H](C(=O)N[C@@H](CCCNC(=O)N)C(=O)O)NC(=O)OC(C)(C)C