Boc-Val-Cit-PABA is a research compound used as a linker building block in antibody-drug conjugate (ADC) development. It contains a tert-butyloxycarbonyl (Boc)-protected valine-citrulline dipeptide linked to a para-aminobenzyl alcohol (PABA) moiety, providing a stable yet cleavable structure for controlled drug release.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 870487-09-5
ALLOC-VAL-CIT-PAB-OH
pharmaceutical intermediate
5-Chloro-3-iodo-2-methylaniline
research compound
4-(1-Naphthyl)phenylboronic Acid (contains varying amounts of Anhydride)
synthetic building block for cross-coupling
2-AMINO-N,3-DIMETHYLBENZAMIDE
research compound for crystallography
3-Amino-5-bromopyridine-2-carboxylic acid
Research compound
tert-butyl N-[(2S)-1-[[(2S)-5-(carbamoylamino)-1-[4-(hydroxymethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate
VYCVAPFXSOAOCL-ROUUACIJSA-N
CC(C)[C@@H](C(=O)N[C@@H](CCCNC(=O)N)C(=O)NC1=CC=C(C=C1)CO)NC(=O)OC(C)(C)C