(R)-1-N-Boc-Pipecolamide is a chiral building block used in peptide synthesis. It features a tert-butoxycarbonyl (Boc) protecting group on the piperidine ring, making it suitable for solid-phase and solution-phase peptide assembly.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 848488-91-5
Tert-Butyl (S)-2-carbamoylpyrrolidine-1-carboxylate
protected proline amide intermediate
Tert-Butyl 2-(aminocarbonyl)pyrrolidine-1-carboxylate
research compound
1-[(tert-butoxy)carbonyl]piperidine-2-carboxylic acid
Boc-protected piperidine carboxylic acid intermediate
(S)-2-Aminobutyramide hydrochloride
peptide synthesis building block
Fmoc-beta-t-butyl-L-alanine
peptide synthesis building block
Fmoc-D-Cys(Trt)-OH
peptide synthesis building block
N-(tert-Butoxycarbonyl)-N-methyl-D-alanine
peptide synthesis building block
Tert-butyl N-[(1R)-1-(4-bromophenyl)-2-hydroxyethyl]carbamate
pharmaceutical intermediate
tert-butyl (2R)-2-carbamoylpiperidine-1-carboxylate
KIFYKONQFFJILQ-MRVPVSSYSA-N
CC(C)(C)OC(=O)N1CCCC[C@@H]1C(=O)N