This compound is a protected proline derivative featuring a tert-butoxycarbonyl (Boc) protecting group and a primary amide at the carboxyl terminus. It is commonly employed as a research reagent in peptide synthesis and biochemical studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 54503-10-5
(R)-1-N-Boc-Pipecolamide
peptide synthesis building block
Tert-butyl 2-carbamoylpiperidine-1-carboxylate
Pharmaceutical intermediate for peptide synthesis
(2R)-1-[(tert-butoxy)carbonyl]pyrrolidine-2-carboxylic acid
Protected amino acid for peptide synthesis
Cycloheptylamine
Research compound
2,6-Pyridinedicarboxylic acid, dimethyl ester
research compound for crystallography
2'-o-(2-methoxyethyl)inosine
RNA modification research reagent
4-Bromo-1,8-naphthyridine
research compound
Tert-Butyl (S)-2-carbamoylpyrrolidine-1-carboxylate
protected proline amide intermediate
tert-butyl 2-carbamoylpyrrolidine-1-carboxylate
PITJAAIPVBVRAO-UHFFFAOYSA-N
CC(C)(C)OC(=O)N1CCCC1C(=O)N