This compound is a Boc-protected derivative of proline, specifically this compound. It serves as a pharmaceutical intermediate for peptide synthesis, enabling the incorporation of a methoxy-substituted proline residue into peptide chains.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 83624-01-5
(3R)-3-amino-3-phenylpropanoic acid hydrochloride
pharmaceutical intermediate for peptide synthesis
N,N-Dimethyl3-Bromo-4-(4-methylphenyl)-4-oxobutanamide
Pharmaceutical intermediate for impurity synthesis
2-Benzyloxy-5-bromopyridine
Pharmaceutical intermediate
5-Methoxyindole-3-butyric acid
pharmaceutical intermediate
(2S,4R)-4-methoxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid
COHIMMPWCAHSFN-SFYZADRCSA-N
CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)O)OC