(3R)-3-Amino-3-phenylpropanoic acid hydrochloride is a chiral amino acid derivative used as a pharmaceutical intermediate. Its primary significance lies in serving as a building block for the synthesis of peptides and other active pharmaceutical ingredients.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 83649-48-3
2-N-Fmoc-aminomethyl piperidine
pharmaceutical intermediate for peptide synthesis
L-tert-Leucine methyl ester hydrochloride
pharmaceutical intermediate for peptide synthesis
(S)-Boc-3-Amino-3-phenylpropan-1-ol
pharmaceutical intermediate for peptide synthesis
(2S)-2-amino-3,3-dimethylbutanamide hydrochloride
pharmaceutical intermediate for peptide synthesis
N,N-Dimethyl3-Bromo-4-(4-methylphenyl)-4-oxobutanamide
Pharmaceutical intermediate for impurity synthesis
2-Benzyloxy-5-bromopyridine
Pharmaceutical intermediate
5-Methoxyindole-3-butyric acid
pharmaceutical intermediate
7-chloro-4-(piperazin-1-yl)quinoline
pharmaceutical intermediate
(3R)-3-amino-3-phenylpropanoic acid;hydrochloride
ABEBCTCOPRULFS-DDWIOCJRSA-N
C1=CC=C(C=C1)[C@@H](CC(=O)O)N.Cl