This compound is a deuterium-labeled form of hexadecanoic acid, where four hydrogen atoms at positions 5 and 6 are replaced with deuterium. It is primarily used as an isotopically labeled fatty acid reference standard in analytical chemistry and research applications.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 75736-47-9
Hexacosanoic acid-d4
Stable isotope labeled reference standard
Lignoceric acid-d4-2
Deuterated fatty acid research standard
Meta-topolin
plant growth regulator research tool
Methan-d3-ol, p-toluenesulfonate
research reagent and reference standard
Tris[4,4'-bis(t-butyl)-2,2'-bipyridine]ruthenium(II) hexafluorophosphate
photoredox catalyst or research reagent
2,3,5-Tribromopyridine
research compound
Palmitic Acid-d4
Deuterated internal standard for fatty acid analysis
Palmitic Acid-d3
Deuterated fatty acid reference standard
5,5,6,6-tetradeuteriohexadecanoic acid
IPCSVZSSVZVIGE-AREBVXNXSA-N
[2H]C([2H])(CCCCCCCCCC)C([2H])([2H])CCCC(=O)O