Meta-topolin is a synthetic cytokinin compound used primarily as a research reagent in plant tissue culture studies. It is investigated for its role in regulating plant growth and development, particularly in mitigating hyperhydricity and improving regeneration efficiency.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 75737-38-1
Methan-d3-ol, p-toluenesulfonate
research reagent and reference standard
Tris[4,4'-bis(t-butyl)-2,2'-bipyridine]ruthenium(II) hexafluorophosphate
photoredox catalyst or research reagent
2,3,5-Tribromopyridine
research compound
2,3-Difluorobenzyl alcohol
research compound
6-Benzylaminopurine
plant growth regulator
3-[(7H-purin-6-ylamino)methyl]phenol
BUDWTFCZGZYQHZ-UHFFFAOYSA-N
C1=CC(=CC(=C1)O)CNC2=NC=NC3=C2NC=N3