3,5-Bis(trifluoromethyl)benzoic acid is a chemical compound featuring a benzoic acid core substituted with two trifluoromethyl groups at the 3 and 5 positions. It is primarily used as an intermediate in the synthesis of pharmaceutical compounds.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 725-89-3
3-Fluoro-5-(trifluoromethyl)benzoic acid
research compound
2-Bromo-1,1-dimethoxyethane
Bromoacetaldehyde dimethyl acetal intermediate
6-Methoxypyridazin-3-amine
Pharmaceutical intermediate
2'-Oxo Ifosfamide
Pharmaceutical intermediate for ifosfamide analogs
Ethyl N-(tert-butoxycarbonyl)-L-tyrosinate
protected amino acid intermediate
3,5-bis(trifluoromethyl)benzoic acid
HVFQJWGYVXKLTE-UHFFFAOYSA-N
C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C(=O)O