3-Fluoro-5-(trifluoromethyl)benzoic acid is a research compound primarily used in laboratory and manufacturing settings. It is a structurally distinct molecule from flufenamic acid, which is an anthranilic acid derivative and NSAID, but the two share certain structural features.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 161622-05-5
3,5-Bis(trifluoromethyl)benzoic acid
Pharmaceutical intermediate synthesis
4-Bromo-3-(trifluoromethyl)benzoic acid
research compound
(S)-1-BENZYL-PYRROLIDINE-3-CARBOXYLIC ACID
Research chemical
1,3-Dibromobenzene-d4
Deuterated research compound
3,4-Difluorohydrocinnamic acid
research compound
3-fluoro-5-(trifluoromethyl)benzoic acid
NSGKIIGVPBTOBF-UHFFFAOYSA-N
C1=C(C=C(C=C1C(F)(F)F)F)C(=O)O
—