This compound is a pharmaceutical intermediate specifically used in the synthesis of dapagliflozin analogs. It is characterized by a complex molecular structure containing multiple hydroxyl groups, ether linkages, and an aromatic ring system.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 714269-57-5
4-(Aminomethyl)piperidine
Pharmaceutical intermediate for synthesis
Methyl 4-aminopyridine-2-carboxylate
Pharmaceutical intermediate
2-(4-Methylphenyl)benzoic acid
pharmaceutical intermediate
2-Bromopropionyl chloride
Pharmaceutical and agrochemical intermediate
Methyl 1-C-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-D-glucopyranoside
pharmaceutical intermediate
(2S,3R,4S,5S)-2-(4-chloro-3-(4-ethoxybenzyl)phenyl)-6,6-bis(hydroxymethyl)-2-methoxytetrahydro-2H-pyran-3,4,5-triol
Pharmaceutical intermediate
(2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol
GKTWLVVOULBRDU-BDHVOXNPSA-N
CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)[C@]3([C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)OC)Cl