This compound is a pharmaceutical intermediate, specifically a key building block used in the synthesis of the drug ertugliflozin. It is characterized as a complex polyhydroxylated molecule containing multiple alcohol and ether functional groups, featuring a tetrahydropyran ring system.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1528636-39-6
2-Propenal, 2-fluoro-3-(4-morpholinyl)-, (Z)-
Pharmaceutical intermediate
3-Chlorobenzyl cyanide
Pharmaceutical intermediate
1-(Hydroxymethyl)cyclopropaneacetonitrile
pharmaceutical intermediate
METHYL 1-(MERCAPTOMETHYL)CYCLOPROPANEACETATE
Pharmaceutical intermediate for synthesis
Methyl 1-C-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-D-glucopyranoside
pharmaceutical intermediate
(2S,3R,4S,5S,6R)-2-(4-Chloro-3-(4-ethoxybenzyl)phenyl)-6-(hydroxymethyl)-2-methoxytetrahydro-2H-pyran-3,4,5-triol
Pharmaceutical intermediate for dapagliflozin analogs
(2S,3R,4S,5S)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6,6-bis(hydroxymethyl)-2-methoxyoxane-3,4,5-triol
BLHXRCSRYWCZJZ-QXUYBEEESA-N
CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)[C@]3([C@@H]([C@H]([C@@H](C(O3)(CO)CO)O)O)O)OC)Cl