3-Deazaadenosine is a research compound used for adenosine receptor studies. It is a structural analog of adenosine where the nitrogen atom at position 3 of the purine ring is replaced by carbon, and it features a ribose sugar moiety with multiple hydroxyl groups.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 6736-58-9
N6-Benzyl-5'-ethylcarboxamido Adenosine
Research compound for adenosine receptor studies
Methyl 2-methoxypyridine-3-carboxylate
Positron emission tomography radiotracer
1,3-Bis(diphenylphosphino)propane
Bidentate phosphine ligand for metal complexes
Decarboxylated S-Adenosylmethionine Sulfate Salt
research compound
Dichlorohexamethylbenzene ruthenium(II) dimer
research reagent for organometallic chemistry
4-Amino-6-chloro-1-b-D-ribofuranosylimidazo[4,5-c]pyridine
Pharmaceutical intermediate and research compound
(2R,3R,4S,5R)-2-(4-aminoimidazo[4,5-c]pyridin-1-yl)-5-(hydroxymethyl)oxolane-3,4-diol
DBZQFUNLCALWDY-PNHWDRBUSA-N
C1=CN=C(C2=C1N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N