1,3-Bis(diphenylphosphino)propane is a bidentate phosphine ligand used in organometallic chemistry. It coordinates to transition metals to form stable complexes, playing a key role in homogeneous catalysis and coordination chemistry research.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
1,3-Bis(diphenylphosphino)propane satın almak mı istiyorsunuz?
Ücretsiz bir satın alma talebi yayınlayın — hesap gerekmez. Talebiniz bu ürünün tedarikçilerine ulaşır, yanıtlar doğrudan e-postanıza gelir.
Dichloro(1,1'-(1,3-propanediyl)bis(1,1-diphenylphosphine-kappaP))nickel
catalyst for organic synthesis
(1,3-Bis(diphenylphosphino)propane)palladium(II) chloride
catalyst for cross-coupling reactions
1,4-Bis(diphenylphosphino)butane
bidentate phosphine ligand
1,6-Bis(diphenylphosphino)hexane
bidentate phosphine ligand for catalysis
1,5-Bis(diphenylphosphino)pentane
organophosphorus ligand for coordination chemistry
(Octane-1,8-diyl)bis(diphenylphosphane)
Bidentate phosphine ligand
Decarboxylated S-Adenosylmethionine Sulfate Salt
research compound
Dichlorohexamethylbenzene ruthenium(II) dimer
research reagent for organometallic chemistry
3-diphenylphosphanylpropyl(diphenyl)phosphane
LVEYOSJUKRVCCF-UHFFFAOYSA-N
C1=CC=C(C=C1)P(CCCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4
1,3-Bis(diphenylphosphino)propane satın almak mı istiyorsunuz?
Ücretsiz bir satın alma talebi yayınlayın — hesap gerekmez. Talebiniz bu ürünün tedarikçilerine ulaşır, yanıtlar doğrudan e-postanıza gelir.