Dimetridazole D3 is a stable isotope labeled reference standard used in analytical research. It is the trideuteriomethyl analog of dimetridazole, a nitroimidazole compound employed as a marker for quantitation in mass spectrometry.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 64678-69-9
4H-Imidazol-4-one, 2-amino-1,5-dihydro-1-(methyl-d3)-
stable isotope labeled reference standard
Leucomalachite Green-d6
stable isotope labeled reference standard
L-Tyrosine-13C6
stable isotope labeled reference standard
Stearoyl-L-carnitine-d3 (chloride)
stable isotope labeled reference standard
2-Bromo-4,5-difluorobenzonitrile
Research compound
2-Bromo-4,5-difluorobenzoic acid
chemical synthesis intermediate
Triisopropylphosphine
Ligand in organometallic chemistry
3,4-Dimethoxyamphetamine, (R)-
research compound
2-methyl-5-nitro-1-(trideuteriomethyl)imidazole
IBXPYPUJPLLOIN-BMSJAHLVSA-N
[2H]C([2H])([2H])N1C(=NC=C1[N+](=O)[O-])C