2-Bromo-4,5-difluorobenzoic acid is a halogenated aromatic carboxylic acid commonly used as a chemical synthesis intermediate. It is typically employed in laboratory and research settings for the preparation of more complex organic molecules.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 64695-84-7
4-bromo-2,5-difluorobenzoic acid
research compound
1-(4-(trifluoromethyl)phenyl)propan-2-one
chemical synthesis intermediate
Methyl 2-Chloro-3-methylbenzoate
chemical synthesis intermediate
2-bromo-5-(trifluoromethyl)phenol
chemical synthesis intermediate
4-Cyanophenyl isocyanate
chemical synthesis intermediate
Triisopropylphosphine
Ligand in organometallic chemistry
3,4-Dimethoxyamphetamine, (R)-
research compound
Quinoline-3-carboxylic acid
research compound
2-bromo-4,5-difluorobenzoic acid
DGCBGBZYTNTZJH-UHFFFAOYSA-N
C1=C(C(=CC(=C1F)F)Br)C(=O)O
—