3-Nitrophthalic anhydride is an organic compound that serves as a key intermediate in the synthesis of pharmaceuticals and fine chemicals. It is characterized by a nitro-substituted phthalic anhydride structure, making it valuable for constructing complex molecular architectures.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 641-70-3
Di-(2-ethylhexyl) terephthalate
Plasticizer for PVC and rubbers
1,2-difluoro-3-(trifluoromethyl)benzene
Industrial chemical intermediate
Sodium isooctadecanoate
surfactant and emulsifier ingredient
Morpholine, 4,4'-(oxydi-2,1-ethanediyl)bis-
Blowing agent for polyurethane foams
TETRACHLOROPHTHALIC ANHYDRIDE
flame retardant and chemical intermediate
3-Chlorophthalic anhydride
Pharmaceutical intermediate for synthesis
4-Chlorophthalic anhydride
Chemical intermediate for dyes and pigments
Trimellitic anhydride chloride
Pharmaceutical intermediate
4-nitro-2-benzofuran-1,3-dione
ROFZMKDROVBLNY-UHFFFAOYSA-N
C1=CC2=C(C(=C1)[N+](=O)[O-])C(=O)OC2=O