1,2-Difluoro-3-(trifluoromethyl)benzene is a fluorinated aromatic compound containing five fluorine atoms. It is primarily used as an industrial chemical intermediate in the synthesis of more complex organic molecules.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 64248-59-5
Sodium isooctadecanoate
surfactant and emulsifier ingredient
Morpholine, 4,4'-(oxydi-2,1-ethanediyl)bis-
Blowing agent for polyurethane foams
Trimethylolpropane tris(2-methyl-1-aziridinepropionate)
crosslinking agent for coatings
O-Phthalaldehyde
reagent for amino acid analysis
1,2-difluoro-3-(trifluoromethyl)benzene
CBOJZWDLNLMBLM-UHFFFAOYSA-N
C1=CC(=C(C(=C1)F)F)C(F)(F)F