(3-Chlorophenyl)(phenyl)methanol is a research compound consisting of a benzhydrol structure bearing a chlorine substituent on one aromatic ring. It is commonly used as a laboratory reagent in chemical and pharmaceutical research.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 63012-03-3
1,7-DICHLORO-4-METHOXYISOQUINOLINE
research compound
(2E)-3-(4-fluoro-3-methoxyphenyl)prop-2-enoic acid
research compound
4-Chloro-2-iodoaniline
research compound
Cyclopentylboronic acid
synthetic intermediate for organoboron chemistry
(3-chlorophenyl)-phenylmethanol
DDCJHFYXAPQYLA-UHFFFAOYSA-N
C1=CC=C(C=C1)C(C2=CC(=CC=C2)Cl)O