This compound is a research compound featuring an aromatic ring with acid, ether, and halogen functional groups. It is primarily used as a laboratory reagent for chemical and pharmaceutical research studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 630424-79-2
3',4'-dimethoxycinnamic acid
research compound
4-Chloro-2-iodoaniline
research compound
Cyclopentylboronic acid
synthetic intermediate for organoboron chemistry
4-Fluoro-2-methylbenzaldehyde
research compound
Tetrapropylammonium iodide
Quaternary ammonium salt reagent
(E)-3-(4-fluoro-3-methoxyphenyl)prop-2-enoic acid
NVEDFCULNXTLOA-HWKANZROSA-N
COC1=C(C=CC(=C1)/C=C/C(=O)O)F
—