1H-Imidazole-4,5-dicarboxylic acid is a chemical compound used as a research reagent, particularly for the synthesis and study of imidazole derivatives. Its structure features an imidazole ring with two carboxylic acid groups, giving it moderate polarity and hydrogen-bonding capacity.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 570-22-9
N-([1,1'-Biphenyl]-4-yl)-[1,1'-biphenyl]-3-amine
TAAR1 agonist research compound
Ethyl 1-(3-chloro-5-((4-(4-chlorothiophen-2-yl)-5-(4-cyclohexylpiperazin-1-yl)thiazol-2-yl)carbamoyl)pyridin-2-yl)piperidine-4-carboxylate
research compound
Dichlorodehydroabietic acid
Reference standard for abietic acid impurity
4-Maleimidobutyric acid
Crosslinking reagent for bioconjugation
1H-imidazole-4,5-dicarboxylic acid
ZEVWQFWTGHFIDH-UHFFFAOYSA-N
C1=NC(=C(N1)C(=O)O)C(=O)O