4-Maleimidobutyric acid is a compound containing a maleimide group and a carboxylic acid, used as a crosslinking reagent in bioconjugation research. It is characterized by its ability to form stable thioether bonds with thiol groups, making it valuable for modifying proteins and other biomolecules.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 57078-98-5
11-Maleimidoundecanoic acid
n.a
7-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)heptanoic acid
research compound
6-Maleimidocaproic acid
Research reagent for bioconjugation
3-Maleimidopropionic acid
pharmaceutical intermediate for bioconjugation
2,5-Dioxopyrrolidin-1-yl 3-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanoate
Crosslinking reagent for bioconjugation
(S)-(-)-3-CYCLOHEXENE-1-CARBOXYLIC ACID
research compound
1H-Imidazole-4-carbonitrile
research compound
4-bromonaphthalen-1-ol
research compound
4-(2,5-dioxopyrrol-1-yl)butanoic acid
NCPQROHLJFARLL-UHFFFAOYSA-N
C1=CC(=O)N(C1=O)CCCC(=O)O