This compound is a chiral carboxylic acid that serves as a key building block in the synthesis of certain pyrethroid insecticides. Its structure features a cyclopropane ring with dichloroethenyl and carboxylic acid substituents, characteristic of a common synthetic intermediate.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 55701-03-6
(1R-trans)-3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride
pyrethroid insecticide intermediate
3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride
Pyrethroid insecticide intermediate
Methyl 2,4-dichlorobenzeneacetate
agrochemical intermediate
Methyl 3-(4-hydroxyphenyl)propionate
nitrification inhibitor and plant growth regulator
Parathion
Insecticide and acaricide
Ethion
Organophosphate insecticide and acaricide
Cis-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropane carboxylic acid
certified reference standard
Cis-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropane carboxylic acid
Pyrethroid insecticide intermediate
cis-(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid
LLMLSUSAKZVFOA-XINAWCOVSA-N
CC1([C@@H]([C@H]1C(=O)O)C=C(Cl)Cl)C