This compound is a cyclopropanecarboxylic acid derivative used as an intermediate in the synthesis of pyrethroid insecticides. Its structure includes a dichloroethenyl side chain and a single carboxylic acid group, conferring properties relevant to agrochemical manufacturing.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 59042-49-8
Cis-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropane carboxylic acid
certified reference standard
(1R-trans)-3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride
pyrethroid insecticide intermediate
3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride
Pyrethroid insecticide intermediate
Terbuthylazine
broad-spectrum herbicide for crops
(1E)-(Pent-1-en-1-yl)boronic acid
agrochemical intermediate
1-Triacontanol
plant growth regulator
Larvin
carbamate insecticide and molluscicide
1R-cis-Permethrinic acid
pharmaceutical intermediate
trans-(1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid
LLMLSUSAKZVFOA-INEUFUBQSA-N
CC1([C@@H]([C@@H]1C(=O)O)C=C(Cl)Cl)C