Z-Phg-OH is a protected phenylglycine derivative used as a building block in peptide synthesis. Its structure features a benzyloxycarbonyl (Cbz) protecting group on the amino function and a free carboxylic acid, making it suitable for solid-phase or solution-phase peptide assembly.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 53990-33-3
(2S,3R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-methoxybutanoic acid
Peptide building block
4-IODOANILINE
pharmaceutical intermediate in organic synthesis
3-AMINOPIPERIDINE
pharmaceutical intermediate
(8S,9S,10R,14S)-13-Ethyl-11-methylidene-1,2,3,6,7,8,9,10,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one
steroid pharmaceutical intermediate
2-Nitro-4-thiocyanatoaniline
Pharmaceutical intermediate
(R)-(((Phenylmethoxy)carbonyl)amino)phenylacetic acid
Peptide synthesis protected amino acid
(S)-Cbz-3-Amino-3-phenylpropan-1-ol
Pharmaceutical intermediate
(R)-Cbz-3-amino-3-phenylpropan-1-ol
pharmaceutical intermediate with carbamate protecting group
(2S)-2-phenyl-2-(phenylmethoxycarbonylamino)acetic acid
RLDJWBVOZVJJOS-AWEZNQCLSA-N
C1=CC=C(C=C1)COC(=O)N[C@@H](C2=CC=CC=C2)C(=O)O