Fisetin is a naturally occurring flavonol found in many fruits and vegetables, recognized for its antioxidant properties and studied as a geroprotector and anti-inflammatory agent. It also functions as an inhibitor of DNA topoisomerase and is investigated in research settings for its potential roles in cellular health.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 528-48-3
Cyanidin chloride
assay reagent
2-Bromopropane-1,1,1,3,3,3-d6
Isotopically labeled reference standard
Acetone hydrazone
research compound
Cyclohexanone, 2,6-bis[(4-azidophenyl)methylene]-4-methyl-
research chemical
Quercetin dihydrate
Dietary supplement and food ingredient
Quercetin
dietary supplement ingredient
2-(3,4-Dihydroxyphenyl)-6-ethyl-3-hydroxychromen-4-one
research compound
Hibiscetin 3,7,4'-trimethyl ether
Research compound
2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one
XHEFDIBZLJXQHF-UHFFFAOYSA-N
C1=CC(=C(C=C1C2=C(C(=O)C3=C(O2)C=C(C=C3)O)O)O)O