Cyanidin chloride is a research reagent and an anthocyanidin compound commonly used as an assay reagent in laboratory studies. It is a salt-like, aromatic, heterocyclic compound with multiple hydroxyl groups, typically investigated for its antioxidant and color-related properties.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 528-58-5
Cyanidin
plant pigment and antioxidant
Adenosine 5'-monophosphoramidate sodium salt
assay reagent
2-Bromopropane-1,1,1,3,3,3-d6
Isotopically labeled reference standard
Acetone hydrazone
research compound
Cyclohexanone, 2,6-bis[(4-azidophenyl)methylene]-4-methyl-
research chemical
1-Methyl-1-propylpyrrolidinium chloride
Ionic liquid research compound
2-(3,4-dihydroxyphenyl)chromenylium-3,5,7-triol chloride
COAWNPJQKJEHPG-UHFFFAOYSA-N
C1=CC(=C(C=C1C2=[O+]C3=CC(=CC(=C3C=C2O)O)O)O)O.[Cl-]