This compound is a protected amino acid intermediate, specifically the benzyl ester of O4-benzyl-L-tyrosine. It features a core tyrosine structure with both amino and carboxyl groups protected, making it suitable for use in peptide synthesis and pharmaceutical manufacturing.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 52799-86-7
Benzyl O-benzyl-L-tyrosinate--hydrogen chloride (1/1)
Research reagent for peptide synthesis
H-Phe-OBzl.TosOH
protected phenylalanine derivative for peptide synthesis
L-Phenylalanine benzyl ester hydrochloride
Peptide synthesis intermediate
O-Benzyl-L-tyrosine
Pharmaceutical intermediate for peptide synthesis
Ethyl N-(tert-butoxycarbonyl)-L-tyrosinate
protected amino acid intermediate
N-(Diphenylmethylene)glycine tert-butyl ester
protected amino acid intermediate
Dicyclohexylamine (S)-2-(((benzyloxy)carbonyl)amino)-4-((tert-butoxycarbonyl)amino)butanoate
protected amino acid intermediate
(2S,3S)-3-(Z-amino)-2-hydroxy-4-phenylbutyric acid
protected amino acid intermediate
benzyl (2S)-2-amino-3-(4-phenylmethoxyphenyl)propanoate
UCRXQUVKDMVBBM-QFIPXVFZSA-N
C1=CC=C(C=C1)COC2=CC=C(C=C2)C[C@@H](C(=O)OCC3=CC=CC=C3)N