O-Benzyl-L-tyrosine is a protected derivative of the amino acid L-tyrosine, featuring a benzyl group attached to the phenolic oxygen. It is primarily used as a building block in solid-phase peptide synthesis, where the benzyl group serves as a temporary protecting group.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 16652-64-5
Benzyl O-benzyl-L-tyrosinate--hydrogen chloride (1/1)
Research reagent for peptide synthesis
(S)-Benzyl 2-amino-3-(4-(benzyloxy)phenyl)propanoate
protected amino acid intermediate
Benzyl L-prolinate HCl
Pharmaceutical intermediate for proline derivatives
H-Ile-Obzl Tos
protected amino acid derivative
O-Benzyl-L-valine toluene-p-sulphonate
Pharmaceutical intermediate for peptide synthesis
4,6-dichloropyridine-3-carbonitrile
Pharmaceutical intermediate for drug synthesis
(2S)-2-amino-3-(4-phenylmethoxyphenyl)propanoic acid
KAFHLONDOVSENM-HNNXBMFYSA-N
C1=CC=C(C=C1)COC2=CC=C(C=C2)C[C@@H](C(=O)O)N