2-(Phenylcarbamoyl)benzoic acid is a chemical compound used as a pharmaceutical intermediate and research compound. Its structure features both carboxylic acid and amide functional groups, contributing to its role in organic synthesis and drug development.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 4727-29-1
1-ETHYL-1-(3,3,5-TRIMETHYLCYCLOHEXYL)PYRROLIDIN-1-IUM HYDROXIDE
structure directing agent
Dichloramine B
Disinfectant and antiseptic agent
Cyclopentyl isocyanate
Isocyanate reagent for synthesis
Ethoxalyl chloride
Acylating agent for organic synthesis
2-methyl-4-[(2-methylbenzoyl)amino]Benzoic acid
Tolvaptan intermediate
Niklozamit
active pharmaceutical ingredient
Benzoic acid, 4-(2-(octyloxy)benzamido)-, 2-(diethylamino)ethyl ester hydrochloride
pharmaceutical research compound
Otilonium Bromide
active pharmaceutical ingredient
2-(phenylcarbamoyl)benzoic acid
DSUPUOGOCIFZBG-UHFFFAOYSA-N
C1=CC=C(C=C1)NC(=O)C2=CC=CC=C2C(=O)O