Dichloramine B is an This compound compound used primarily as a disinfectant and antiseptic agent.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 473-29-0
Chloramine-T trihydrate
Disinfectant and antiseptic agent
Iodine
Disinfectant and antiseptic agent
Capitol Records
Disinfectant and antiseptic agent
Cyclopentyl isocyanate
Isocyanate reagent for synthesis
Ethoxalyl chloride
Acylating agent for organic synthesis
N-Methyl-o-phenylenediamine
chemical intermediate for dyes and pigments
2,2-Bis(hydroxymethyl)propionic acid
Biodegradable polymer and coating intermediate
N,N-dichlorobenzenesulfonamide
PJBJJXCZRAHMCK-UHFFFAOYSA-N
C1=CC=C(C=C1)S(=O)(=O)N(Cl)Cl