3-(Pyridin-4-yl)benzoic acid is a research compound used in crystallography studies. Its structure features both aromatic and heterocyclic rings, making it a subject of structural analysis.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 4385-78-8
10,10'-DIBROMO-9,9'-BIANTHRACENE
Research compound for crystallography studies
3,5-Difluorophenol
Research compound for crystallography studies
Ethyl (2Z)-2-chloro-2-[2-(4-methoxyphenyl)hydrazinylidene]acetate
Research compound for crystallography studies
(2-amino-5-ethylthiophen-3-yl)(2-chlorophenyl)methanone
Research compound for crystallography studies
(S)-4-(4,7-Bis(2-(tert-butoxy)-2-oxoethyl)-1,4,7-triazonan-1-yl)-5-(tert-butoxy)-5-oxopentanoic acid
research reagent
6-(Trifluoromethyl)pyridine-3,4-diamine
research compound
2-Amino-6-methylbenzoic acid
research compound
2-((3,3-dibutyl-7-(methylthio)-1,1-dioxido-5-phenyl-2,3,4,5-tetrahydrobenzo[b][1,4]thiazepin-8-yl)oxy)acetic acid
research compound
3-pyridin-4-ylbenzoic acid
IYGIZNZSONLPSI-UHFFFAOYSA-N
C1=CC(=CC(=C1)C(=O)O)C2=CC=NC=C2