This compound is a research reagent characterized by a benzothiazepine core structure with butyl, phenyl, and acetic acid substituents. Its significance lies in its use as a laboratory chemical for investigational studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 439088-13-8
Elobixibat
ileal bile acid transporter inhibitor
3,3-Dibutyl-8-hydroxy-7-(methylthio)-5-phenyl-2,3,4,5-tetrahydrobenzo[b][1,4]thiazepine 1,1-dioxide
Pharmaceutical intermediate for research
7-Bromo-3,3-dibutyl-8-methoxy-2,3-dihydrobenzo[b][1,4]thiazepin-4(5H)-one
research compound for structural studies
[Rh COD (R)-Binap]BF4
chiral organometallic catalyst
2,3,4,5,6-Pentafluorobenzyl alcohol
fluorinated benzyl alcohol reagent
6,6'-Dimethyl-2,2'-bipyridine
ligand for metal coordination chemistry
2-[(3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1lambda6,5-benzothiazepin-8-yl)oxy]acetic acid
HLVCNERLDVNLEF-UHFFFAOYSA-N
CCCCC1(CN(C2=CC(=C(C=C2S(=O)(=O)C1)OCC(=O)O)SC)C3=CC=CC=C3)CCCC
—