4-(2-Pyridyl)benzoic acid is a chemical compound used as a research reagent. It contains both aromatic rings and a carboxylic acid functional group, making it useful in laboratory syntheses and impurity studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 4385-62-0
4-(4-pyridyl)benzoic acid
research compound
3-(Pyridin-3-yl)benzoic acid
research compound
3-(Pyridin-4-yl)benzoic acid
Research compound for crystallography studies
(S)-4-(4,7-Bis(2-(tert-butoxy)-2-oxoethyl)-1,4,7-triazonan-1-yl)-5-(tert-butoxy)-5-oxopentanoic acid
research reagent
(2,2'-Bipyridyl)bis[2-(4-fluorophenyl)pyridine]iridium(III) hexafluorophosphate
organometallic research compound
4-pyridin-2-ylbenzaldehyde
Pharmaceutical intermediate
Bis [2- (2,4-difluorophenyl) -5-trifluoromethylpyridine] [1,10-phenanthroline] iridium hexafluorophosphate
research compound
TERT-BUTYL 2-(4-(PYRIDIN-2-YL)BENZYL)HYDRAZINECARBOXYLATE
pharmaceutical intermediate
4-pyridin-2-ylbenzoic acid
AQIPNZHMXANQRC-UHFFFAOYSA-N
C1=CC=NC(=C1)C2=CC=C(C=C2)C(=O)O