Cbz-D-Homoserine lactone is a research compound featuring a benzyloxycarbonyl (Cbz) protecting group attached to the D-isomer of homoserine lactone. Its structure includes an aromatic ring and an ester-containing heterocyclic lactone ring, making it a useful building block in peptide synthesis and organic chemistry research.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 41088-89-5
N-Carbobenzyloxy-D-serine-beta-lactone
beta-lactone pharmaceutical intermediate
(S)-BENZYL (2-OXOOXETAN-3-YL)CARBAMATE
research compound
Lithium diisopropylamide
strong base in organic synthesis
Cyclopropylboronic acid
boronic acid research reagent
Ethyl carbazate
research compound
Dimethyl(2-oxo-4-phenylbutyl)phosphonate
research compound
N-Cbz-L-homoserine lactone
peptide synthesis intermediate
benzyl N-[(3R)-2-oxooxolan-3-yl]carbamate
FKWDZIFOVOUDAG-SNVBAGLBSA-N
C1COC(=O)[C@@H]1NC(=O)OCC2=CC=CC=C2