Dimethyl(2-oxo-4-phenylbutyl)phosphonate is a research compound containing a phosphonate ester group and an aromatic ring. It is primarily used as a laboratory reagent for chemical synthesis and investigative studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 41162-19-0
2,4-Dimethylpyrimidin-5-ol
research reagent
(1-2H1)Acetaldehyde
deuterium-labeled reference standard
Potassium tert-amylate
strong base reagent
3-(2-bromo-4,5-dimethoxyphenyl)-2-cyanoacrylic acid
Research compound
1-dimethoxyphosphoryl-4-phenylbutan-2-one
ONYIBVIIOCEBIV-UHFFFAOYSA-N
COP(=O)(CC(=O)CCC1=CC=CC=C1)OC