Dihydrofolic acid (DHF) is a derivative of folic acid (vitamin B9) that serves as a substrate in folate metabolism. It is converted to tetrahydrofolic acid by the enzyme dihydrofolate reductase, a step essential for the synthesis of purines and pyrimidines, the building blocks of DNA and RNA.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 4033-27-6
(R)-alpha-Propargylalanine
research compound for peptide synthesis
3,4-DIMETHOXYBENZOPHENONE
research compound
(S)-4-Methyloxazolidin-2-one
research compound
Piperidine-2-carboxylic acid
research compound
10-Formyldihydrofolate
research compound for folate metabolism
(2S)-2-[[4-[(2-amino-4-oxo-7,8-dihydro-3H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid
OZRNSSUDZOLUSN-LBPRGKRZSA-N
C1C(=NC2=C(N1)N=C(NC2=O)N)CNC3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)O)C(=O)O