3,4-Dimethoxybenzophenone is a research compound structurally defined as This compound. It features a benzophenone core with two methoxy substituents on one aromatic ring, contributing to its physicochemical properties such as moderate lipophilicity and low molecular weight.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 4038-14-6
(S)-4-Methyloxazolidin-2-one
research compound
Piperidine-2-carboxylic acid
research compound
DICYCLOHEXYL(4-(N,N-DIMETHYLAMINO)PHENYL)PHOSPHINE
organophosphine ligand for catalysis
2,3-dihydro-1H-indene-4-carboxylic Acid
Research compound for organic synthesis
(3,4-dimethoxyphenyl)-phenylmethanone
WCNOATOQNSHEFK-UHFFFAOYSA-N
COC1=C(C=C(C=C1)C(=O)C2=CC=CC=C2)OC