This compound is a deuterated fatty acid used primarily as a research reagent. Its fully deuterated structure makes it suitable for tracer studies and analytical chemistry applications where isotopic labeling is required.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 39756-32-6
Dodecanoic-d23 acid
isotopically labeled research reference standard
Undecanoic acid-d21
deuterated fatty acid research reagent
Tetradecanoic-d27 acid
Deuterated fatty acid standard
Hexadecanoic-d31 acid
Deuterated reference standard for fatty acid analysis
2-Propanol-1,1,1,3,3,3-d6
Deuterated internal standard for NMR
2-amino-6-methylpyrimidin-4-one
biochemical precursor to thiamine pyrophosphate
Dimethyl 2,3-difluoromaleate
specialty chemical intermediate
6-phenylpyridin-2-amine
research compound
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,20-nonatriacontadeuterioicosanoic acid
VKOBVWXKNCXXDE-BKDZISOFSA-N
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O