Hexadecanoic-d31 acid is a deuterated form of palmitic acid, a C16 straight-chain saturated fatty acid in which the aliphatic hydrogen atoms have been replaced by deuterium. It is primarily used as a reference standard in analytical chemistry for the quantification and identification of fatty acids by mass spectrometry.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 39756-30-4
Eicosanoic-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,20-d39 acid
Deuterated fatty acid for research
Dodecanoic-d23 acid
isotopically labeled research reference standard
Undecanoic acid-d21
deuterated fatty acid research reagent
Tetradecanoic-d27 acid
Deuterated fatty acid standard
2-Propanol-1,1,1,3,3,3-d6
Deuterated internal standard for NMR
2-amino-6-methylpyrimidin-4-one
biochemical precursor to thiamine pyrophosphate
Dimethyl 2,3-difluoromaleate
specialty chemical intermediate
6-phenylpyridin-2-amine
research compound
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-hentriacontadeuteriohexadecanoic acid
IPCSVZSSVZVIGE-SAQPIRCFSA-N
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O