(2-Bromoethyl)benzene-d5 is a deuterated research reagent used in chemical and pharmaceutical research. Its structure features a bromoethyl group attached to a pentadeuterated benzene ring, making it useful as an internal standard or labeled compound in analytical studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 35845-64-8
4-Bromo-2,8-bis(trifluoromethyl)quinoline
research compound
5-Bromo-6-chloropyridin-2-amine
research compound
4-Phenylbutyric Acid-d11
deuterated research compound
Diisobutyl Phthalate-d4
isotopically labeled research compound
(2-BROMOETHYL)BENZENE
pharmaceutical intermediate for beta-phenethyl derivatives
1-(2-bromoethyl)-2,3,4,5,6-pentadeuteriobenzene
WMPPDTMATNBGJN-RALIUCGRSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])CCBr)[2H])[2H]