4-Phenylbutyric Acid-d11 is a deuterated research compound, specifically a stable isotope-labeled analog of 4-phenylbutyric acid in which eleven hydrogen atoms are replaced by deuterium. Its primary significance lies in its use as a research reagent, enabling analytical and metabolic studies through isotope tracing.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 358730-86-6
Diisobutyl Phthalate-d4
isotopically labeled research compound
4-Nonylphenol-D5
Deuterated analytical reference standard
Dicyclohexyl phthalate-3,4,5,6-d4
Deuterated analytical reference standard
2,6-DICHLOROTOLUENE-3,4,5-D3
Deuterated research compound
Sodium 4-phenylbutyrate
active pharmaceutical ingredient
4-PHENYLBUTYRIC ACID
Histone deacetylase inhibitor
2,2,3,3,4,4-hexadeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)butanoic acid
OBKXEAXTFZPCHS-VRWITDQQSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O)[2H])[2H]