7-methyl-L-tryptophan is a research compound. It is a derivative of the amino acid L-tryptophan, characterized by the presence of a methyl group at the 7-position of the indole ring.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 33468-36-9
4-chloro-6-methoxy-2-methyl-3-propylquinoline
research compound
Di-tert-butyl hydrogen phosphate; potassium salt
Phosphate ester salt reagent
(Z)-N-Ethyl-N-methyl-2-oxo-3-(phenyl((4-(piperidin-1-ylmethyl)phenyl)amino)methylene)indoline-6-carboxamide
research compound
1,2-Dihydroxybenzene-1-13c
Isotope-labeled research compound
(2S)-2-amino-3-(7-methyl-1H-indol-3-yl)propanoic acid
KBOZNJNHBBROHM-JTQLQIEISA-N
CC1=C2C(=CC=C1)C(=CN2)C[C@@H](C(=O)O)N