This compound is a potassium salt of a phosphate ester, commonly utilized as a laboratory reagent in chemical research and synthesis. Its structure features a phosphate group with two tert-butyl substituents and a potassium counterion, conferring specific solubility and reactivity properties.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 33494-80-3
(Z)-N-Ethyl-N-methyl-2-oxo-3-(phenyl((4-(piperidin-1-ylmethyl)phenyl)amino)methylene)indoline-6-carboxamide
research compound
1,2-Dihydroxybenzene-1-13c
Isotope-labeled research compound
Norleual
research compound
(2S)-2-[(2-Methylpropan-2-yl)oxycarbonylamino](1,2,3-13C3)propanoic acid
Isotopically labeled amino acid derivative
SZCKQRFZBSIRLK-UHFFFAOYSA-N
CC(C)(C)OP(=O)(O)OC(C)(C)C.[K]
—